CAS 192329-94-5 appears in our catalog under these names: 4-(Pyridin-2-yloxy)benzene-1-sulfonyl chloride, 95%, 4–(Pyridin–2–Yloxy)Benzene–1–Sulfonyl Chloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
4-pyridin-2-yloxybenzenesulfonyl chloride (CAS 192329-94-5) is a chemical compound with the molecular formula C11H8ClNO3S and a molecular weight of 269.70 g/mol. IUPAC name: 4-pyridin-2-yloxybenzenesulfonyl chloride. InChIKey: CXLPHVTZYYDWQX-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3S |
|---|---|
| Molecular weight | 269.70 g/mol |
| IUPAC name | 4-pyridin-2-yloxybenzenesulfonyl chloride |
| InChIKey | CXLPHVTZYYDWQX-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)OC2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)