Products 192329-94-5

CAS 192329-94-5 appears in our catalog under these names: 4-(Pyridin-2-yloxy)benzene-1-sulfonyl chloride, 95%, 4–(Pyridin–2–Yloxy)Benzene–1–Sulfonyl Chloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.

Structural formula: {0} (CAS {1})

4-pyridin-2-yloxybenzenesulfonyl chloride (CAS 192329-94-5) is a chemical compound with the molecular formula C11H8ClNO3S and a molecular weight of 269.70 g/mol. IUPAC name: 4-pyridin-2-yloxybenzenesulfonyl chloride. InChIKey: CXLPHVTZYYDWQX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8ClNO3S
Molecular weight269.70 g/mol
IUPAC name4-pyridin-2-yloxybenzenesulfonyl chloride
InChIKeyCXLPHVTZYYDWQX-UHFFFAOYSA-N
SMILESC1=CC=NC(=C1)OC2=CC=C(C=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)