CAS 368869-91-4 appears in our catalog under these names: 6-Phenoxy-3-pyridinesulfonyl chloride, 96%, 6-Phenoxypyridine-3-sulfonyl chloride, 95+%, 6-Phenoxypyridine-3-sulfonyl chloride, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g.
6-phenoxypyridine-3-sulfonyl chloride (CAS 368869-91-4) is a chemical compound with the molecular formula C11H8ClNO3S and a molecular weight of 269.70 g/mol. IUPAC name: 6-phenoxypyridine-3-sulfonyl chloride. InChIKey: AHTIUBWJNYRYLG-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3S |
|---|---|
| Molecular weight | 269.70 g/mol |
| IUPAC name | 6-phenoxypyridine-3-sulfonyl chloride |
| InChIKey | AHTIUBWJNYRYLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)