CAS 192329-81-0 is the registry number for 4–(4–pyridyloxy)benzenesulfonyl chloride. Offered by: GLPBio. Available pack sizes: 200mg.
4-pyridin-4-yloxybenzenesulfonyl chloride (CAS 192329-81-0) is a chemical compound with the molecular formula C11H8ClNO3S and a molecular weight of 269.70 g/mol. IUPAC name: 4-pyridin-4-yloxybenzenesulfonyl chloride. InChIKey: FFFLYOYQSHCTRS-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3S |
|---|---|
| Molecular weight | 269.70 g/mol |
| IUPAC name | 4-pyridin-4-yloxybenzenesulfonyl chloride |
| InChIKey | FFFLYOYQSHCTRS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC=NC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)