CAS 680618-20-6 is the registry number for 5-(Formylamino)-1-naphthalenesulfonyl Chloride. Offered by: TRC. Available pack sizes: 5g.
5-formamidonaphthalene-1-sulfonyl chloride (CAS 680618-20-6) is a chemical compound with the molecular formula C11H8ClNO3S and a molecular weight of 269.70 g/mol. IUPAC name: 5-formamidonaphthalene-1-sulfonyl chloride. InChIKey: CINVSSZEEOERHL-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3S |
|---|---|
| Molecular weight | 269.70 g/mol |
| IUPAC name | 5-formamidonaphthalene-1-sulfonyl chloride |
| InChIKey | CINVSSZEEOERHL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2S(=O)(=O)Cl)C(=C1)NC=O |
Computed by PubChem (NCBI)