CAS 949259-81-8 appears in our catalog under these names: 2-(4-Chlorophenoxymethyl)-1,3-thiazole-4-carboxylic acid, 95%, 2-(4-Chlorophenoxymethyl)-1,3-thiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-[(4-chlorophenoxy)methyl]-1,3-thiazole-4-carboxylic acid (CAS 949259-81-8) is a chemical compound with the molecular formula C11H8ClNO3S and a molecular weight of 269.70 g/mol. IUPAC name: 2-[(4-chlorophenoxy)methyl]-1,3-thiazole-4-carboxylic acid. InChIKey: UOTHAPWMGICKEA-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3S |
|---|---|
| Molecular weight | 269.70 g/mol |
| IUPAC name | 2-[(4-chlorophenoxy)methyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | UOTHAPWMGICKEA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCC2=NC(=CS2)C(=O)O)Cl |
Computed by PubChem (NCBI)