CAS 123296-71-9 appears in our catalog under these names: 3,4-Dihydro-2H-1,4-benzoxazine-5-carboxylic acid, 98%, 3,4-Dihydro-2H-1,4-benzoxazine-5-carboxylic acid, 3,4-Dihydro-2H-benzo[b][1,4]oxazine-5-carboxylic acid, 98%, 98%, 3,4-Dihydro-2H-benzo[b][1,4]oxazine-5-carboxylic acid, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 0,5g, 100mg.
3,4-dihydro-2H-1,4-benzoxazine-5-carboxylic acid (CAS 123296-71-9) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 3,4-dihydro-2H-1,4-benzoxazine-5-carboxylic acid. InChIKey: PXUXUJPEQCJYIM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 3,4-dihydro-2H-1,4-benzoxazine-5-carboxylic acid |
| InChIKey | PXUXUJPEQCJYIM-UHFFFAOYSA-N |
| SMILES | C1COC2=CC=CC(=C2N1)C(=O)O |
Computed by PubChem (NCBI)