CAS 1235439-29-8 appears in our catalog under these names: 2-((Diphenylmethyl)amino)acetic acid hydrochloride, 95%, 2-((Diphenylmethyl)amino)acetic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(benzhydrylamino)acetic acid;hydrochloride (CAS 1235439-29-8) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 277.74 g/mol. IUPAC name: 2-(benzhydrylamino)acetic acid;hydrochloride. InChIKey: FHWSJVWIVPKMIC-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO2 |
|---|---|
| Molecular weight | 277.74 g/mol |
| IUPAC name | 2-(benzhydrylamino)acetic acid;hydrochloride |
| InChIKey | FHWSJVWIVPKMIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)NCC(=O)O.Cl |
Computed by PubChem (NCBI)