CAS 123622-48-0 appears in our catalog under these names: 5–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)pentanoic acid, Fmoc-5-Ava-OH, 5-(Fmoc-amino)valeric acid, 98% , Fmoc-5-Ava-OH 98%, FMOC-5-AVA-OH, >=98.0%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 10g, 25g, 1g, 5g, 500g, 25 g, 10 g.
5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 123622-48-0) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: ULLSWWGYZWBPHK-UHFFFAOYSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | ULLSWWGYZWBPHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCC(=O)O |
Computed by PubChem (NCBI)