Products 1236353-78-8
CAS 1236353-78-8 appears in our catalog under these names: (R)–Methyl 3–(1–aminoethyl)benzoate hydrochloride, (R)-Methyl 3-(1-aminoethyl)benzoate Hydrochloride, (R)-Methyl 3-(1-aminoethyl)benzoate hydrochloride, 99%, 99%, (R)-Methyl 3-(1-aminoethyl)benzoate hydrochloride, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 50mg.
Methyl 3-[(1R)-1-aminoethyl]benzoate;hydrochloride (CAS 1236353-78-8) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl 3-[(1R)-1-aminoethyl]benzoate;hydrochloride. InChIKey: PMFQSOTUHJSZHY-OGFXRTJISA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl 3-[(1R)-1-aminoethyl]benzoate;hydrochloride |
| InChIKey | PMFQSOTUHJSZHY-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)C(=O)OC)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-Methyl 3-(1-aminoethyl)benzoate hydrochloride, (R)-3-(1-Amino-ethyl)-benzoic acid methyl ester hydrochloride, methyl 3-[(1R)-1-aminoethyl]benzoate;hydrochloride, (R)-Methyl 3-(1-aminoethyl)benzoate HCl, methyl 3-[(1R)-1-aminoethyl]benzoate hydrochloride, methyl (R)-3-(1-aminoethyl)benzoate hydrochloride, (R)-3-(1-Amino-ethyl)-benzoicacidmethylesterhydrochloride