CAS 1263378-68-2 appears in our catalog under these names: Methyl 3-(1-aminoethyl)benzoate hydrochloride, 95%, Methyl 3–(1–Aminoethyl)benzoate Hydrochloride, Methyl 3-(1-Aminoethyl)benzoate Hydrochloride, 97%, 97%, Methyl 3-(1-aminoethyl)benzoate hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg, 500mg, 5g.
Methyl 3-(1-aminoethyl)benzoate;hydrochloride (CAS 1263378-68-2) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl 3-(1-aminoethyl)benzoate;hydrochloride. InChIKey: PMFQSOTUHJSZHY-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl 3-(1-aminoethyl)benzoate;hydrochloride |
| InChIKey | PMFQSOTUHJSZHY-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)C(=O)OC)N.Cl |
Computed by PubChem (NCBI)