Products 123687-40-1
CAS 123687-40-1 appears in our catalog under these names: 1,1'–(Oxybis(ethane–2,1–diyl))bis(1H–pyrrole–2,5–dione), 1,1'-(Oxybis(ethane-2,1-diyl))bis(1H-pyrrole-2,5-dione), 98%, 98%, Mal-PEG1-Mal, Mal-PEG1-Mal, 98%, 1,1'-(Oxybis(ethane-2,1-diyl))bis(1H-pyrrole-2,5-dione), 99%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 500mg, 50mg, 100mg, 25 mg, 100 mg, 250 mg.
1-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl]pyrrole-2,5-dione (CAS 123687-40-1) is a chemical compound with the molecular formula C12H12N2O5 and a molecular weight of 264.23 g/mol. IUPAC name: 1-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl]pyrrole-2,5-dione. InChIKey: VWGJOEJUQXVFPK-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O5 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | 1-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl]pyrrole-2,5-dione |
| InChIKey | VWGJOEJUQXVFPK-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)