Products 123843-65-2
CAS 123843-65-2 appears in our catalog under these names: 2,6-Difluoro-4-methoxybenzoic acid, 98%, 2,6–Difluoro–4–methoxybenzoic acid, 2,6-Difluoro-4-methoxybenzoic acid 95%, 2,6-Difluoro-4-methoxybenzoic acid, 95%, 95%, 2,6-Difluoro-4-methoxybenzoic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 10g, 100g.
2,6-difluoro-4-methoxybenzoic acid (CAS 123843-65-2) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 2,6-difluoro-4-methoxybenzoic acid. InChIKey: LGHVYSAINQRZJQ-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2,6-difluoro-4-methoxybenzoic acid |
| InChIKey | LGHVYSAINQRZJQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)F)C(=O)O)F |
Computed by PubChem (NCBI)