CAS 1398065-61-6 appears in our catalog under these names: Diphenyl Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, Diphenyl Phthalate-3,4,5,6-d4, >95% (HPLC), Phthalic acid, bis-phenyl ester D4, Diphenyl phthalate–3,4,5,6–d4, Diphenyl phthalate-3,4,5,6-d4. Offered by: CDN, TRC, Dr. Ehrenstorfer, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10mg, 1mg, 2mg, 5mg, 1 mg, 5 mg.
Diphenyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (CAS 1398065-61-6) is a chemical compound with the molecular formula C20H14O4 and a molecular weight of 322.3 g/mol. IUPAC name: diphenyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate. InChIKey: DWNAQMUDCDVSLT-ZZRPVTOQSA-N.
| Molecular formula | C20H14O4 |
|---|---|
| Molecular weight | 322.3 g/mol |
| IUPAC name | diphenyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChIKey | DWNAQMUDCDVSLT-ZZRPVTOQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OC2=CC=CC=C2)C(=O)OC3=CC=CC=C3)[2H])[2H] |
Computed by PubChem (NCBI)