Products 13653-84-4
CAS 13653-84-4 appears in our catalog under these names: [1,1':4',1''-Terphenyl]-4,4''-dicarboxylic Acid, 95%, (p-Terphenyl)-4,4''-dicarboxylic Acid, Rink Amide Resin, p-Terphenyl-4,4′′-dicarboxylic acid 95%, [1,1':4',1''-Terphenyl]-4,4''-dicarboxylic acid, 95%, 95%. Offered by: Fluorochem, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 500mg, 100g, 2g.
4-[4-(4-carboxyphenyl)phenyl]benzoic acid (CAS 13653-84-4) is a chemical compound with the molecular formula C20H14O4 and a molecular weight of 318.3 g/mol. IUPAC name: 4-[4-(4-carboxyphenyl)phenyl]benzoic acid. InChIKey: FZTIWOBQQYPTCJ-UHFFFAOYSA-N.
| Molecular formula | C20H14O4 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | 4-[4-(4-carboxyphenyl)phenyl]benzoic acid |
| InChIKey | FZTIWOBQQYPTCJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C(=O)O)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)