Products 123958-84-9
CAS 123958-84-9 appears in our catalog under these names: 5-Chlorosulfonyl-2-methoxybenzoic Acid-d3, 5-(Chlorosulfonyl)-2-(methoxy-d3)benzoic acid. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 25mg, 5mg, 25 mg, 5 mg, 100 mg.
5-chlorosulfonyl-2-(trideuteriomethoxy)benzoic acid (CAS 123958-84-9) is a chemical compound with the molecular formula C8H7ClO5S and a molecular weight of 253.68 g/mol. IUPAC name: 5-chlorosulfonyl-2-(trideuteriomethoxy)benzoic acid. InChIKey: OUBZCDOQEMLMAB-FIBGUPNXSA-N.
| Molecular formula | C8H7ClO5S |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | 5-chlorosulfonyl-2-(trideuteriomethoxy)benzoic acid |
| InChIKey | OUBZCDOQEMLMAB-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)