Products 1856658-28-0
CAS 1856658-28-0 is the registry number for Indapamide Impurity 6. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-chloro-3-methoxysulfonylbenzoic acid (CAS 1856658-28-0) is a chemical compound with the molecular formula C8H7ClO5S and a molecular weight of 250.66 g/mol. IUPAC name: 4-chloro-3-methoxysulfonylbenzoic acid. InChIKey: PBUZKGCMJDDMGX-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO5S |
|---|---|
| Molecular weight | 250.66 g/mol |
| IUPAC name | 4-chloro-3-methoxysulfonylbenzoic acid |
| InChIKey | PBUZKGCMJDDMGX-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)C1=C(C=CC(=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)