CAS 50803-29-7 appears in our catalog under these names: 3-(Chlorosulfonyl)-4-methoxybenzoic acid, 95%, 3–(Chlorosulfonyl)–4–methoxybenzoic acid. Offered by: Combi-blocks, GLPBio, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 10g.
3-chlorosulfonyl-4-methoxybenzoic acid (CAS 50803-29-7) is a chemical compound with the molecular formula C8H7ClO5S and a molecular weight of 250.66 g/mol. IUPAC name: 3-chlorosulfonyl-4-methoxybenzoic acid. InChIKey: OWBBPHXIAFVUMO-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO5S |
|---|---|
| Molecular weight | 250.66 g/mol |
| IUPAC name | 3-chlorosulfonyl-4-methoxybenzoic acid |
| InChIKey | OWBBPHXIAFVUMO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)