CAS 51904-91-7 appears in our catalog under these names: 5-Chlorosulfonyl-2-methoxybenzoic acid, 95%, Salicylic Acid Impurity 15, Sulpiride Impurity 15, 5-Chlorosulfonyl-2-methoxybenzoic acid, 5-Chlorosulfonyl-2-methoxybenzoic acid, 98%. Offered by: Combi-blocks, Chemat Brand, Biosynth, Fluorochem, Ambeed. Available pack sizes: 25g, 250mg, 5g, 1g, on request, 10g.
5-chlorosulfonyl-2-methoxybenzoic acid (CAS 51904-91-7) is a chemical compound with the molecular formula C8H7ClO5S and a molecular weight of 250.66 g/mol. IUPAC name: 5-chlorosulfonyl-2-methoxybenzoic acid. InChIKey: OUBZCDOQEMLMAB-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO5S |
|---|---|
| Molecular weight | 250.66 g/mol |
| IUPAC name | 5-chlorosulfonyl-2-methoxybenzoic acid |
| InChIKey | OUBZCDOQEMLMAB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)