Products 912577-38-9

CAS 912577-38-9 is the registry number for Amisulpride Impurity 28. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-chlorosulfonyl-2-methoxybenzoic acid (CAS 912577-38-9) is a chemical compound with the molecular formula C8H7ClO5S and a molecular weight of 250.66 g/mol. IUPAC name: 3-chlorosulfonyl-2-methoxybenzoic acid. InChIKey: LOZARFNPWCWQBE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClO5S
Molecular weight250.66 g/mol
IUPAC name3-chlorosulfonyl-2-methoxybenzoic acid
InChIKeyLOZARFNPWCWQBE-UHFFFAOYSA-N
SMILESCOC1=C(C=CC=C1S(=O)(=O)Cl)C(=O)O

Computed by PubChem (NCBI)