Products 926270-90-8
CAS 926270-90-8 appears in our catalog under these names: 5-(Chlorosulfonyl)-2-hydroxy-4-methylbenzoic acid, 95%, 5-(Chlorosulfonyl)-2-hydroxy-4-methylbenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-chlorosulfonyl-2-hydroxy-4-methylbenzoic acid (CAS 926270-90-8) is a chemical compound with the molecular formula C8H7ClO5S and a molecular weight of 250.66 g/mol. IUPAC name: 5-chlorosulfonyl-2-hydroxy-4-methylbenzoic acid. InChIKey: NYXCIPXHNVJEIO-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO5S |
|---|---|
| Molecular weight | 250.66 g/mol |
| IUPAC name | 5-chlorosulfonyl-2-hydroxy-4-methylbenzoic acid |
| InChIKey | NYXCIPXHNVJEIO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1S(=O)(=O)Cl)C(=O)O)O |
Computed by PubChem (NCBI)