CAS 926214-03-1 is the registry number for 3-(Chlorosulfonyl)-2-hydroxy-5-methylbenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-chlorosulfonyl-2-hydroxy-5-methylbenzoic acid (CAS 926214-03-1) is a chemical compound with the molecular formula C8H7ClO5S and a molecular weight of 250.66 g/mol. IUPAC name: 3-chlorosulfonyl-2-hydroxy-5-methylbenzoic acid. InChIKey: IOIVRGPONCBMQY-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO5S |
|---|---|
| Molecular weight | 250.66 g/mol |
| IUPAC name | 3-chlorosulfonyl-2-hydroxy-5-methylbenzoic acid |
| InChIKey | IOIVRGPONCBMQY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)S(=O)(=O)Cl)O)C(=O)O |
Computed by PubChem (NCBI)