Products 926214-03-1

CAS 926214-03-1 is the registry number for 3-(Chlorosulfonyl)-2-hydroxy-5-methylbenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-chlorosulfonyl-2-hydroxy-5-methylbenzoic acid (CAS 926214-03-1) is a chemical compound with the molecular formula C8H7ClO5S and a molecular weight of 250.66 g/mol. IUPAC name: 3-chlorosulfonyl-2-hydroxy-5-methylbenzoic acid. InChIKey: IOIVRGPONCBMQY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClO5S
Molecular weight250.66 g/mol
IUPAC name3-chlorosulfonyl-2-hydroxy-5-methylbenzoic acid
InChIKeyIOIVRGPONCBMQY-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)S(=O)(=O)Cl)O)C(=O)O

Computed by PubChem (NCBI)