Products 41490-08-8

CAS 41490-08-8 appears in our catalog under these names: 3,5-Dichloro-4-ethoxybenzoic acid, 95%, 3,5-Dichloro-4-ethoxybenzoic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3,5-dichloro-4-ethoxybenzoic acid (CAS 41490-08-8) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: 3,5-dichloro-4-ethoxybenzoic acid. InChIKey: SXYGOCJUQOJEPU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Cl2O3
Molecular weight235.06 g/mol
IUPAC name3,5-dichloro-4-ethoxybenzoic acid
InChIKeySXYGOCJUQOJEPU-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1Cl)C(=O)O)Cl

Computed by PubChem (NCBI)