CAS 25140-90-3 appears in our catalog under these names: 2-(2,6-Dichlorophenoxy)propanoic acid, 97%, 2-(2,6-Dichlorophenoxy)propionic Acid, 2-(2,6-Dichlorophenoxy)propanoic acid, 95+%, 2,6-Dichlorprop, 2-(2,6-Dichlorophenoxy)propanoic acid 95+%. Offered by: Combi-blocks, TRC, AmBeed, Dr. Ehrenstorfer, Chemat. Available pack sizes: 1g, 250mg, 5g, 2,5g, 50mg, 100mg, 1x50mg.
2-(2,6-dichlorophenoxy)propanoic acid (CAS 25140-90-3) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: 2-(2,6-dichlorophenoxy)propanoic acid. InChIKey: JTSKVVDMNKQPAO-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 2-(2,6-dichlorophenoxy)propanoic acid |
| InChIKey | JTSKVVDMNKQPAO-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=C(C=CC=C1Cl)Cl |
Computed by PubChem (NCBI)