CAS 165377-90-2 appears in our catalog under these names: Methyl 2,5-dichloro-3-methoxybenzoate, 95%, Methyl 2,5-dichloro-3-methoxybenzoate 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 50mg.
Methyl 2,5-dichloro-3-methoxybenzoate (CAS 165377-90-2) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: methyl 2,5-dichloro-3-methoxybenzoate. InChIKey: LXFFJZLHTMOKFP-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | methyl 2,5-dichloro-3-methoxybenzoate |
| InChIKey | LXFFJZLHTMOKFP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1Cl)C(=O)OC)Cl |
Computed by PubChem (NCBI)