CAS 124035-08-1 appears in our catalog under these names: 5–Chloro–2–cyclohexyl–1H–benzo(d)imidazole, 5-Chloro-2-cyclohexyl-1H-benzo[d]imidazole 95+%, 5-CHLORO-2-CYCLOHEXYL-1H-BENZIMIDAZOLE, 95+%, 95+%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-chloro-2-cyclohexyl-1H-benzimidazole (CAS 124035-08-1) is a chemical compound with the molecular formula C13H15ClN2 and a molecular weight of 234.72 g/mol. IUPAC name: 6-chloro-2-cyclohexyl-1H-benzimidazole. InChIKey: UKHBTBNWIXGYOW-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | 6-chloro-2-cyclohexyl-1H-benzimidazole |
| InChIKey | UKHBTBNWIXGYOW-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=NC3=C(N2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)