CAS 75333-07-2 is the registry number for ((1,1'–Biphenyl)–4–ylmethyl)hydrazine hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
[(4-phenylphenyl)methylamino]azanium chloride (CAS 75333-07-2) is a chemical compound with the molecular formula C13H15ClN2 and a molecular weight of 234.72 g/mol. IUPAC name: [(4-phenylphenyl)methylamino]azanium chloride. InChIKey: YAFQLYLYAHBUNE-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | [(4-phenylphenyl)methylamino]azanium chloride |
| InChIKey | YAFQLYLYAHBUNE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CN[NH3+].[Cl-] |
Computed by PubChem (NCBI)