CAS 96329-22-5 appears in our catalog under these names: 1-(Diphenylmethyl)hydrazine hydrochloride, 95%, 1–benzhydrylhydrazine hydrochloride, (Diphenylmethyl)hydrazine hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 100mg, 10g, 250mg, 5g, 1g, 25g.
Benzhydrylhydrazine;hydrochloride (CAS 96329-22-5) is a chemical compound with the molecular formula C13H15ClN2 and a molecular weight of 234.72 g/mol. IUPAC name: benzhydrylhydrazine;hydrochloride. InChIKey: GSOMNZHHJATIBW-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | benzhydrylhydrazine;hydrochloride |
| InChIKey | GSOMNZHHJATIBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)NN.Cl |
Computed by PubChem (NCBI)