CAS 1376054-51-1 appears in our catalog under these names: 4-(2-Phenylethyl)pyridin-2-amine hydrochloride, 98%, 4-(2-Phenylethyl)pyridin-2-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(2-phenylethyl)pyridin-2-amine;hydrochloride (CAS 1376054-51-1) is a chemical compound with the molecular formula C13H15ClN2 and a molecular weight of 234.72 g/mol. IUPAC name: 4-(2-phenylethyl)pyridin-2-amine;hydrochloride. InChIKey: WNMHPDYSPQJFRC-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | 4-(2-phenylethyl)pyridin-2-amine;hydrochloride |
| InChIKey | WNMHPDYSPQJFRC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=CC(=NC=C2)N.Cl |
Computed by PubChem (NCBI)