CAS 5705-15-7 appears in our catalog under these names: 1-Benzyl-1-phenylhydrazine hydrochloride, 98%, N-Benzyl-N-phenylhydrazine hydrochloride, 98+% , 1-Benzyl-1-phenylhydrazine hydrochloride, 1-Benzyl-1-phenylhydrazine Hydrochloride, >98.0%(T), 1-Benzyl-1-phenylhydrazine hydrochloride, 98%,RG, 98%,RG. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Chemat. Available pack sizes: 25g, 100g, 1g, 5g, 50g, 500g.
1-benzyl-1-phenylhydrazine;hydrochloride (CAS 5705-15-7) is a chemical compound with the molecular formula C13H15ClN2 and a molecular weight of 234.72 g/mol. IUPAC name: 1-benzyl-1-phenylhydrazine;hydrochloride. InChIKey: JTYLHYOCBGPMNO-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | 1-benzyl-1-phenylhydrazine;hydrochloride |
| InChIKey | JTYLHYOCBGPMNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)