CAS 816438-46-7 appears in our catalog under these names: Vilazodone Impurity B, 3-(4-Chlorobutyl)indoline-5-carbonitrile. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g.
3-(4-chlorobutyl)-2,3-dihydro-1H-indole-5-carbonitrile (CAS 816438-46-7) is a chemical compound with the molecular formula C13H15ClN2 and a molecular weight of 234.72 g/mol. IUPAC name: 3-(4-chlorobutyl)-2,3-dihydro-1H-indole-5-carbonitrile. InChIKey: PKRPAFIHHMAPOO-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | 3-(4-chlorobutyl)-2,3-dihydro-1H-indole-5-carbonitrile |
| InChIKey | PKRPAFIHHMAPOO-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(N1)C=CC(=C2)C#N)CCCCCl |
Computed by PubChem (NCBI)