CAS 702628-06-6 is the registry number for (6-Chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)methanamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)methanamine (CAS 702628-06-6) is a chemical compound with the molecular formula C13H15ClN2 and a molecular weight of 234.72 g/mol. IUPAC name: (6-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)methanamine. InChIKey: UMKZRYDOOBGQAK-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | (6-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)methanamine |
| InChIKey | UMKZRYDOOBGQAK-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C3=C(N2)C=CC(=C3)Cl)CN |
Computed by PubChem (NCBI)