CAS 1240611-21-5 appears in our catalog under these names: 2–(5–bromopyridin–2–yl)–2,2–difluoroacetic acid, 2-(5-bromopyridin-2-yl)-2,2-difluoroacetic acid, 98%, 98%, 2-(5-bromopyridin-2-yl)-2,2-difluoroacetic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-(5-bromo-2-pyridinyl)-2,2-difluoroacetic acid (CAS 1240611-21-5) is a chemical compound with the molecular formula C7H4BrF2NO2 and a molecular weight of 252.01 g/mol. IUPAC name: 2-(5-bromo-2-pyridinyl)-2,2-difluoroacetic acid. InChIKey: MCXGNMNQGZVDRF-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO2 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | 2-(5-bromo-2-pyridinyl)-2,2-difluoroacetic acid |
| InChIKey | MCXGNMNQGZVDRF-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Br)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)