Products 1241684-29-6
CAS 1241684-29-6 appears in our catalog under these names: Estrone-2,3,4-13C3 solution, ESTRONE-2,3,4-13C3, 99 ATOM % 13C, 98 &, ESTRONE-2,3,4-13C3, 99 ATOM % 13C, 98, Estrone-13C3, 98.0%. Offered by: Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1ml, 10MG, 1MG, 5MG, 1 mg.
(8R,9S,13S,14S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (CAS 1241684-29-6) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 273.34 g/mol. IUPAC name: (8R,9S,13S,14S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one. InChIKey: DNXHEGUUPJUMQT-JTCDCFKFSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 273.34 g/mol |
| IUPAC name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| InChIKey | DNXHEGUUPJUMQT-JTCDCFKFSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=[13CH][13C](=[13CH]4)O |
Computed by PubChem (NCBI)