CAS 56588-58-0 appears in our catalog under these names: Estrone-d2, Estrone D2 (16,16-D2), Estrone-16,16-d2, 98 atom % D, min 98% Chemical Purity, Estrone-d2-1, 99.75%. Offered by: TRC, Dr. Ehrenstorfer, CDN, Biosynth, MedChemExpress. Available pack sizes: 50mg, 5mg, 10mg, 0,05g, 0,01g, 25mg, 100mg, 5 mg.
(8R,9S,13S,14S)-16,16-dideuterio-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one (CAS 56588-58-0) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 272.4 g/mol. IUPAC name: (8R,9S,13S,14S)-16,16-dideuterio-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one. InChIKey: DNXHEGUUPJUMQT-XIMAIENTSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | (8R,9S,13S,14S)-16,16-dideuterio-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one |
| InChIKey | DNXHEGUUPJUMQT-XIMAIENTSA-N |
| SMILES | [2H]C1(C[C@H]2[C@@H]3CCC4=C([C@H]3CC[C@@]2(C1=O)C)C=CC(=C4)O)[2H] |
Computed by PubChem (NCBI)