CAS 350820-16-5 appears in our catalog under these names: Estrone-2,4-d2, >95% (HPLC), Estrone-2,4-d2, 98 atom % D, min 98% Chemical Purity, Estrone–d2, Estrone-d2, 99.78%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 500μg, 1 mg.
(8R,9S,13S,14S)-2,4-dideuterio-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (CAS 350820-16-5) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 272.4 g/mol. IUPAC name: (8R,9S,13S,14S)-2,4-dideuterio-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one. InChIKey: DNXHEGUUPJUMQT-HUQKQUBWSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | (8R,9S,13S,14S)-2,4-dideuterio-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| InChIKey | DNXHEGUUPJUMQT-HUQKQUBWSA-N |
| SMILES | [2H]C1=CC2=C(CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C)C(=C1O)[2H] |
Computed by PubChem (NCBI)