CAS 124221-71-2 appears in our catalog under these names: 3'-Aminobiphenyl-3-carboxylic acid, 97%, 3'–Amino–(1,1'–biphenyl)–3–carboxylic acid, 3'-Amino-biphenyl-3-carboxylic acid, 3'-Amino-[1,1'-biphenyl]-3-carboxylic acid 97%, 3'-Aminobiphenyl-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g.
3-(3-aminophenyl)benzoic acid (CAS 124221-71-2) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 3-(3-aminophenyl)benzoic acid. InChIKey: RQKFSJNOPKCEJI-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 3-(3-aminophenyl)benzoic acid |
| InChIKey | RQKFSJNOPKCEJI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)