CAS 1242830-36-9 appears in our catalog under these names: 4-Bromo-2-iodophenylacetic acid, 95%, 2-(4-Bromo-2-iodophenyl)acetic acid, 95+%, 4–BROMO–2–IODOPHENYLACETIC ACID, 2-(4-Bromo-2-iodophenyl)acetic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 50mg, 0,5g.
2-(4-bromo-2-iodophenyl)acetic acid (CAS 1242830-36-9) is a chemical compound with the molecular formula C8H6BrIO2 and a molecular weight of 340.94 g/mol. IUPAC name: 2-(4-bromo-2-iodophenyl)acetic acid. InChIKey: CXFLYYYYDDDXSG-UHFFFAOYSA-N.
| Molecular formula | C8H6BrIO2 |
|---|---|
| Molecular weight | 340.94 g/mol |
| IUPAC name | 2-(4-bromo-2-iodophenyl)acetic acid |
| InChIKey | CXFLYYYYDDDXSG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)I)CC(=O)O |
Computed by PubChem (NCBI)