Products 1243407-85-3

CAS 1243407-85-3 is the registry number for 4-Cyclopropoxy-3-nitrobenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-cyclopropyloxy-3-nitrobenzoic acid (CAS 1243407-85-3) is a chemical compound with the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. IUPAC name: 4-cyclopropyloxy-3-nitrobenzoic acid. InChIKey: ZPHQCOIYOZSLKA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO5
Molecular weight223.18 g/mol
IUPAC name4-cyclopropyloxy-3-nitrobenzoic acid
InChIKeyZPHQCOIYOZSLKA-UHFFFAOYSA-N
SMILESC1CC1OC2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)