CAS 1245569-30-5 appears in our catalog under these names: 2-[3-(4-Chlorophenyl)-1,2,4-oxadiazol-5-yl]ethan-1-amine hydrochloride, 95%, {2-(3-(4-Chlorophenyl)-1,2,4-oxadiazol-5-yl)ethyl}amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2,5g.
2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride (CAS 1245569-30-5) is a chemical compound with the molecular formula C10H11Cl2N3O and a molecular weight of 260.12 g/mol. IUPAC name: 2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride. InChIKey: DMNJYTOVLQOADW-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N3O |
|---|---|
| Molecular weight | 260.12 g/mol |
| IUPAC name | 2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride |
| InChIKey | DMNJYTOVLQOADW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)CCN)Cl.Cl |
Computed by PubChem (NCBI)