Products 2989508-28-1
CAS 2989508-28-1 appears in our catalog under these names: 1-(2,3-Dichlorophenyl)-4-nitroso Piperazine, 1-(2,3-dichlorophenyl)-4-nitrosopiperazine, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 250mg, 100mg, 1g.
1-(2,3-dichlorophenyl)-4-nitrosopiperazine (CAS 2989508-28-1) is a chemical compound with the molecular formula C10H11Cl2N3O and a molecular weight of 260.12 g/mol. IUPAC name: 1-(2,3-dichlorophenyl)-4-nitrosopiperazine. InChIKey: IBXYJRGCUQRECX-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N3O |
|---|---|
| Molecular weight | 260.12 g/mol |
| IUPAC name | 1-(2,3-dichlorophenyl)-4-nitrosopiperazine |
| InChIKey | IBXYJRGCUQRECX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=C(C(=CC=C2)Cl)Cl)N=O |
Computed by PubChem (NCBI)