CAS 65936-24-5 is the registry number for 4-Methoxy Clonidine, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
N-(2,6-dichloro-4-methoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine (CAS 65936-24-5) is a chemical compound with the molecular formula C10H11Cl2N3O and a molecular weight of 260.12 g/mol. IUPAC name: N-(2,6-dichloro-4-methoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine. InChIKey: UNLQUNJKRARBMB-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N3O |
|---|---|
| Molecular weight | 260.12 g/mol |
| IUPAC name | N-(2,6-dichloro-4-methoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine |
| InChIKey | UNLQUNJKRARBMB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Cl)NC2=NCCN2)Cl |
Computed by PubChem (NCBI)