CAS 2172498-34-7 is the registry number for 4-(3-Aminophenyl)pyrimidin-2(1H)-one dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
6-(3-aminophenyl)-1H-pyrimidin-2-one;dihydrochloride (CAS 2172498-34-7) is a chemical compound with the molecular formula C10H11Cl2N3O and a molecular weight of 260.12 g/mol. IUPAC name: 6-(3-aminophenyl)-1H-pyrimidin-2-one;dihydrochloride. InChIKey: IRDRMUJYSHDEIL-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N3O |
|---|---|
| Molecular weight | 260.12 g/mol |
| IUPAC name | 6-(3-aminophenyl)-1H-pyrimidin-2-one;dihydrochloride |
| InChIKey | IRDRMUJYSHDEIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC=NC(=O)N2.Cl.Cl |
Computed by PubChem (NCBI)