Products 1248594-31-1
CAS 1248594-31-1 is the registry number for 3-((3,5-Dichloropyridin-2-yl)amino)piperidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(3,5-dichloro-2-pyridinyl)amino]piperidin-2-one (CAS 1248594-31-1) is a chemical compound with the molecular formula C10H11Cl2N3O and a molecular weight of 260.12 g/mol. IUPAC name: 3-[(3,5-dichloro-2-pyridinyl)amino]piperidin-2-one. InChIKey: SBHZLDBFGMYFKJ-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N3O |
|---|---|
| Molecular weight | 260.12 g/mol |
| IUPAC name | 3-[(3,5-dichloro-2-pyridinyl)amino]piperidin-2-one |
| InChIKey | SBHZLDBFGMYFKJ-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)NC1)NC2=C(C=C(C=N2)Cl)Cl |
Computed by PubChem (NCBI)