CAS 1245569-83-8 is the registry number for (3-(4-Chlorobenzyl)-1,2,4-oxadiazol-5-yl)methanamine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-[(4-chlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride (CAS 1245569-83-8) is a chemical compound with the molecular formula C10H11Cl2N3O and a molecular weight of 260.12 g/mol. IUPAC name: [3-[(4-chlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride. InChIKey: JUPCVGYUSJKTEP-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N3O |
|---|---|
| Molecular weight | 260.12 g/mol |
| IUPAC name | [3-[(4-chlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride |
| InChIKey | JUPCVGYUSJKTEP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NOC(=N2)CN)Cl.Cl |
Computed by PubChem (NCBI)