CAS 1306605-82-2 appears in our catalog under these names: 2-(3-(3-Chlorophenyl)-1,2,4-oxadiazol-5-yl)ethan-1-amine hydrochloride, 95%, 2-(3-(3-Chlorophenyl)-1,2,4-oxadiazol-5-yl)ethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride (CAS 1306605-82-2) is a chemical compound with the molecular formula C10H11Cl2N3O and a molecular weight of 260.12 g/mol. IUPAC name: 2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride. InChIKey: XNNVJCUDYZHHID-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N3O |
|---|---|
| Molecular weight | 260.12 g/mol |
| IUPAC name | 2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride |
| InChIKey | XNNVJCUDYZHHID-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NOC(=N2)CCN.Cl |
Computed by PubChem (NCBI)