CAS 1245772-06-8 is the registry number for 1-Butyl-4-chloro-3-methyl-1H-pyrazole-5-carbaldehyde. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-butyl-4-chloro-3-methylpyrazole-5-carbaldehyde (CAS 1245772-06-8) is a chemical compound with the molecular formula C9H13ClN2O and a molecular weight of 200.66 g/mol. IUPAC name: 1-butyl-4-chloro-3-methylpyrazole-5-carbaldehyde. InChIKey: PLLATTBIZKSVIK-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | 1-butyl-4-chloro-3-methylpyrazole-5-carbaldehyde |
| InChIKey | PLLATTBIZKSVIK-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=C(C(=N1)C)Cl)C=O |
Computed by PubChem (NCBI)