CAS 124658-76-0 is the registry number for Salbutamol Impurity 113. Offered by: Chemat Brand. Available pack sizes: on request.
(2-formylphenyl) 2-bromoacetate (CAS 124658-76-0) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: (2-formylphenyl) 2-bromoacetate. InChIKey: FNLOIMSSKSYIPU-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | (2-formylphenyl) 2-bromoacetate |
| InChIKey | FNLOIMSSKSYIPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)OC(=O)CBr |
Computed by PubChem (NCBI)