CAS 1246817-11-7 is the registry number for 3-(N-Methyl-N-pentyl-amino)propionic Acid-d3 Hydrochloride. Offered by: TRC. Available pack sizes: 50mg, 5mg.
3-[pentyl(trideuteriomethyl)amino]propanoic acid;hydrochloride (CAS 1246817-11-7) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 212.73 g/mol. IUPAC name: 3-[pentyl(trideuteriomethyl)amino]propanoic acid;hydrochloride. InChIKey: YDWXRULMHQZBEX-MUTAZJQDSA-N.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 212.73 g/mol |
| IUPAC name | 3-[pentyl(trideuteriomethyl)amino]propanoic acid;hydrochloride |
| InChIKey | YDWXRULMHQZBEX-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])N(CCCCC)CCC(=O)O.Cl |
Computed by PubChem (NCBI)