Products 1246817-11-7

CAS 1246817-11-7 is the registry number for 3-(N-Methyl-N-pentyl-amino)propionic Acid-d3 Hydrochloride. Offered by: TRC. Available pack sizes: 50mg, 5mg.

Structural formula: {0} (CAS {1})

3-[pentyl(trideuteriomethyl)amino]propanoic acid;hydrochloride (CAS 1246817-11-7) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 212.73 g/mol. IUPAC name: 3-[pentyl(trideuteriomethyl)amino]propanoic acid;hydrochloride. InChIKey: YDWXRULMHQZBEX-MUTAZJQDSA-N.

Identity
Molecular formulaC9H20ClNO2
Molecular weight212.73 g/mol
IUPAC name3-[pentyl(trideuteriomethyl)amino]propanoic acid;hydrochloride
InChIKeyYDWXRULMHQZBEX-MUTAZJQDSA-N
SMILES[2H]C([2H])([2H])N(CCCCC)CCC(=O)O.Cl

Computed by PubChem (NCBI)