CAS 1246818-81-4 is the registry number for N7-(2-Hydroxyethyl)guanine-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
2-amino-7-(1,1,2,2-tetradeuterio-2-hydroxyethyl)-1H-purin-6-one (CAS 1246818-81-4) is a chemical compound with the molecular formula C7H9N5O2 and a molecular weight of 199.20 g/mol. IUPAC name: 2-amino-7-(1,1,2,2-tetradeuterio-2-hydroxyethyl)-1H-purin-6-one. InChIKey: OCAWYYAMQRJCOY-LNLMKGTHSA-N.
| Molecular formula | C7H9N5O2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 2-amino-7-(1,1,2,2-tetradeuterio-2-hydroxyethyl)-1H-purin-6-one |
| InChIKey | OCAWYYAMQRJCOY-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)N1C=NC2=C1C(=O)NC(=N2)N |
Computed by PubChem (NCBI)