Products 1246818-81-4

CAS 1246818-81-4 is the registry number for N7-(2-Hydroxyethyl)guanine-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.

Structural formula: {0} (CAS {1})

2-amino-7-(1,1,2,2-tetradeuterio-2-hydroxyethyl)-1H-purin-6-one (CAS 1246818-81-4) is a chemical compound with the molecular formula C7H9N5O2 and a molecular weight of 199.20 g/mol. IUPAC name: 2-amino-7-(1,1,2,2-tetradeuterio-2-hydroxyethyl)-1H-purin-6-one. InChIKey: OCAWYYAMQRJCOY-LNLMKGTHSA-N.

Identity
Molecular formulaC7H9N5O2
Molecular weight199.20 g/mol
IUPAC name2-amino-7-(1,1,2,2-tetradeuterio-2-hydroxyethyl)-1H-purin-6-one
InChIKeyOCAWYYAMQRJCOY-LNLMKGTHSA-N
SMILES[2H]C([2H])(C([2H])([2H])O)N1C=NC2=C1C(=O)NC(=N2)N

Computed by PubChem (NCBI)