CAS 6011-55-8 is the registry number for Pyridine-2,5-dicarbohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Pyridine-2,5-dicarbohydrazide (CAS 6011-55-8) is a chemical compound with the molecular formula C7H9N5O2 and a molecular weight of 195.18 g/mol. IUPAC name: pyridine-2,5-dicarbohydrazide. InChIKey: OTPQUWGVUDNOLP-UHFFFAOYSA-N.
| Molecular formula | C7H9N5O2 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | pyridine-2,5-dicarbohydrazide |
| InChIKey | OTPQUWGVUDNOLP-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)NN)C(=O)NN |
Computed by PubChem (NCBI)